CAS 60821-63-8 is the registry number for 1-(1-Methyl-2,3-dihydro-1h-indol-5-yl)-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-(1-methyl-2,3-dihydroindol-5-yl)ethanone (CAS 60821-63-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-(1-methyl-2,3-dihydroindol-5-yl)ethanone. InChIKey: YYLSIIQLPZYTTJ-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-(1-methyl-2,3-dihydroindol-5-yl)ethanone |
| InChIKey | YYLSIIQLPZYTTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)N(CC2)C |
Computed by PubChem (NCBI)