CAS 81586-39-2 appears in our catalog under these names: (-)-trans-Delta-9-THC-D3 (Dronabinol), 0.1mg/ml in Ethanol, (-)-trans-Delta-9-THC-D3 (Dronabinol), 10mg/ml in Ethanol, (-)-trans-Delta-9-THC-D3 (Dronabinol), 1mg/ml in Ethanol, delta.9-THC-d3 CRM. Offered by: Lipomed, Biosynth. Available pack sizes: 1ml, 1g, 0,5g, 2g, 5g.
(6aR,10aR)-6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (CAS 81586-39-2) is a chemical compound with the molecular formula C21H30O2 and a molecular weight of 317.5 g/mol. IUPAC name: (6aR,10aR)-6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol. InChIKey: CYQFCXCEBYINGO-MVOYJBSWSA-N.
| Molecular formula | C21H30O2 |
|---|---|
| Molecular weight | 317.5 g/mol |
| IUPAC name | (6aR,10aR)-6,6,9-trimethyl-3-(5,5,5-trideuteriopentyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | CYQFCXCEBYINGO-MVOYJBSWSA-N |
| SMILES | [2H]C([2H])([2H])CCCCC1=CC(=C2[C@@H]3C=C(CC[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)