CAS 609-88-1 is the registry number for 1,2,5-Trimethyl-3-nitrobenzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,5-trimethyl-3-nitrobenzene (CAS 609-88-1) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. IUPAC name: 1,2,5-trimethyl-3-nitrobenzene. InChIKey: QCZUVZZGFJABPY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 1,2,5-trimethyl-3-nitrobenzene |
| InChIKey | QCZUVZZGFJABPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])C)C |
Computed by PubChem (NCBI)