CAS 60907-89-3 is the registry number for 2,4-Dichloro-1-(1-chloroethyl)benzene, 95+%. Offered by: AmBeed. Available pack sizes: 10g.
2,4-dichloro-1-(1-chloroethyl)benzene (CAS 60907-89-3) is a chemical compound with the molecular formula C8H7Cl3 and a molecular weight of 209.5 g/mol. IUPAC name: 2,4-dichloro-1-(1-chloroethyl)benzene. InChIKey: WHSUAIALLMIQGU-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3 |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,4-dichloro-1-(1-chloroethyl)benzene |
| InChIKey | WHSUAIALLMIQGU-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)