CAS 958027-87-7 is the registry number for 1,3-Dichloro-2-(2-chloroethyl)benzene, 98%. Offered by: AmBeed. Available pack sizes: 25g.
1,3-dichloro-2-(2-chloroethyl)benzene (CAS 958027-87-7) is a chemical compound with the molecular formula C8H7Cl3 and a molecular weight of 209.5 g/mol. IUPAC name: 1,3-dichloro-2-(2-chloroethyl)benzene. InChIKey: VXFHBHKYFGRDLX-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3 |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 1,3-dichloro-2-(2-chloroethyl)benzene |
| InChIKey | VXFHBHKYFGRDLX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CCCl)Cl |
Computed by PubChem (NCBI)