Products 609805-42-7

CAS 609805-42-7 is the registry number for rac-(1R,4R)-4-(Dimethylamino)cyclohexane-1-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(dimethylamino)cyclohexane-1-carboxylic acid;hydrochloride (CAS 609805-42-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: 4-(dimethylamino)cyclohexane-1-carboxylic acid;hydrochloride. InChIKey: YCMKZNQQFRLCRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18ClNO2
Molecular weight207.70 g/mol
IUPAC name4-(dimethylamino)cyclohexane-1-carboxylic acid;hydrochloride
InChIKeyYCMKZNQQFRLCRZ-UHFFFAOYSA-N
SMILESCN(C)C1CCC(CC1)C(=O)O.Cl

Computed by PubChem (NCBI)