CAS 610261-05-7 is the registry number for 5-(4-Fluorophenyl)-4-hydrazinylthieno(2,3-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine (CAS 610261-05-7) is a chemical compound with the molecular formula C12H9FN4S and a molecular weight of 260.29 g/mol. IUPAC name: [5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine. InChIKey: FIUCRKAZFZIXKQ-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4S |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | [5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]hydrazine |
| InChIKey | FIUCRKAZFZIXKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=NC=NC(=C23)NN)F |
Computed by PubChem (NCBI)