CAS 749920-75-0 is the registry number for 6-(4-Fluorophenyl)-4-hydrazinylthieno(3,2-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 10g.
[6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]hydrazine (CAS 749920-75-0) is a chemical compound with the molecular formula C12H9FN4S and a molecular weight of 260.29 g/mol. IUPAC name: [6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]hydrazine. InChIKey: RFZYITSBCANCEE-UHFFFAOYSA-N.
| Molecular formula | C12H9FN4S |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | [6-(4-fluorophenyl)thieno[3,2-d]pyrimidin-4-yl]hydrazine |
| InChIKey | RFZYITSBCANCEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(S2)C(=NC=N3)NN)F |
Computed by PubChem (NCBI)