CAS 610274-24-3 appears in our catalog under these names: 1-[1-(4-Bromophenyl)-2,5-dimethyl-1h-pyrrol-3-yl]-2-chloroethanone, 95%, 1-(1-(4-Bromophenyl)-2,5-dimethyl-1H-pyrrol-3-yl)-2-chloroethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g.
1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone (CAS 610274-24-3) is a chemical compound with the molecular formula C14H13BrClNO and a molecular weight of 326.61 g/mol. IUPAC name: 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone. InChIKey: ITDXFQDOFWXRRU-UHFFFAOYSA-N.
| Molecular formula | C14H13BrClNO |
|---|---|
| Molecular weight | 326.61 g/mol |
| IUPAC name | 1-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-chloroethanone |
| InChIKey | ITDXFQDOFWXRRU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)Br)C)C(=O)CCl |
Computed by PubChem (NCBI)