CAS 763133-29-5 is the registry number for 2-[(4-Bromo-3-methylanilino)methyl]-4-chlorobenzenol, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-[(4-bromo-3-methylanilino)methyl]-4-chlorophenol (CAS 763133-29-5) is a chemical compound with the molecular formula C14H13BrClNO and a molecular weight of 326.61 g/mol. IUPAC name: 2-[(4-bromo-3-methylanilino)methyl]-4-chlorophenol. InChIKey: FCYZWVQLGLLNAW-UHFFFAOYSA-N.
| Molecular formula | C14H13BrClNO |
|---|---|
| Molecular weight | 326.61 g/mol |
| IUPAC name | 2-[(4-bromo-3-methylanilino)methyl]-4-chlorophenol |
| InChIKey | FCYZWVQLGLLNAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NCC2=C(C=CC(=C2)Cl)O)Br |
Computed by PubChem (NCBI)