CAS 610274-73-2 appears in our catalog under these names: 3-Amino-2,6-dimethyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%, 3-Amino-2,6-dimethyl-5-(p-tolyl)thieno(2,3-d)pyrimidin-4(3H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-amino-2,6-dimethyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one (CAS 610274-73-2) is a chemical compound with the molecular formula C15H15N3OS and a molecular weight of 285.4 g/mol. IUPAC name: 3-amino-2,6-dimethyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one. InChIKey: PUIJVCFPPSNXQA-UHFFFAOYSA-N.
| Molecular formula | C15H15N3OS |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 3-amino-2,6-dimethyl-5-(4-methylphenyl)thieno[2,3-d]pyrimidin-4-one |
| InChIKey | PUIJVCFPPSNXQA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(SC3=C2C(=O)N(C(=N3)C)N)C |
Computed by PubChem (NCBI)