CAS 704910-88-3 appears in our catalog under these names: Esomeprazole Impurity 26, Des-Methoxy Esomeprazole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole (CAS 704910-88-3) is a chemical compound with the molecular formula C15H15N3OS and a molecular weight of 285.4 g/mol. IUPAC name: 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole. InChIKey: YNRXQBPXUVQHBZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3OS |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-2-pyridinyl)methylsulfinyl]-1H-benzimidazole |
| InChIKey | YNRXQBPXUVQHBZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)CS(=O)C2=NC3=CC=CC=C3N2)C |
Computed by PubChem (NCBI)