CAS 61172-66-5 appears in our catalog under these names: 2-{[(tert-Butoxy)carbonyl]amino}pent-4-ynoic acid, 95%, 2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid, 98%, 2-(Boc-amino)-4-pentynoic acid, Boc-DL-Pra-OH 95%, 2-((tert-Butoxycarbonyl)amino)pent-4-ynoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 10g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid (CAS 61172-66-5) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid. InChIKey: AMKHAJIFPHJYMH-UHFFFAOYSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-ynoic acid |
| InChIKey | AMKHAJIFPHJYMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC#C)C(=O)O |
Computed by PubChem (NCBI)