Products 612-50-0

CAS 612-50-0 is the registry number for 6-Ethoxy-2,4-dimethylquinoline. Offered by: TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 500mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

6-ethoxy-2,4-dimethylquinoline (CAS 612-50-0) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 6-ethoxy-2,4-dimethylquinoline. InChIKey: FSBLFAZODHUWJO-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO
Molecular weight201.26 g/mol
IUPAC name6-ethoxy-2,4-dimethylquinoline
InChIKeyFSBLFAZODHUWJO-UHFFFAOYSA-N
SMILESCCOC1=CC2=C(C=C1)N=C(C=C2C)C

Computed by PubChem (NCBI)