Products 61207-61-2
CAS 61207-61-2 is the registry number for 2-Iodo-2-methylpropane-d9, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,1,1,3,3,3-hexadeuterio-2-iodo-2-(trideuteriomethyl)propane (CAS 61207-61-2) is a chemical compound with the molecular formula C4H9I and a molecular weight of 193.07 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuterio-2-iodo-2-(trideuteriomethyl)propane. InChIKey: ANGGPYSFTXVERY-GQALSZNTSA-N.
| Molecular formula | C4H9I |
|---|---|
| Molecular weight | 193.07 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuterio-2-iodo-2-(trideuteriomethyl)propane |
| InChIKey | ANGGPYSFTXVERY-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])I |
Computed by PubChem (NCBI)