Products 61235-23-2
CAS 61235-23-2 appears in our catalog under these names: 11–Hydroxybisabola–1，3，5–trien–9–one, 11-Hydroxybisabola-1,3,5-trien-9-one. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-hydroxy-2-methyl-6-(4-methylphenyl)heptan-4-one (CAS 61235-23-2) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: 2-hydroxy-2-methyl-6-(4-methylphenyl)heptan-4-one. InChIKey: XOILAZXNTMGJRR-UHFFFAOYSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | 2-hydroxy-2-methyl-6-(4-methylphenyl)heptan-4-one |
| InChIKey | XOILAZXNTMGJRR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)CC(=O)CC(C)(C)O |
Computed by PubChem (NCBI)