CAS 612480-60-1 appears in our catalog under these names: 4,4'-Dihydroxybiphenyl-d8 (rings-d8), 98 atom % D, min 98% Chemical Purity, 4,4'-Dihydroxybiphenyl-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)phenol (CAS 612480-60-1) is a chemical compound with the molecular formula C12H10O2 and a molecular weight of 194.25 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)phenol. InChIKey: VCCBEIPGXKNHFW-PGRXLJNUSA-N.
| Molecular formula | C12H10O2 |
|---|---|
| Molecular weight | 194.25 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)phenol |
| InChIKey | VCCBEIPGXKNHFW-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)