Products 6129-62-0

CAS 6129-62-0 is the registry number for 2-Bromo-2,3,3,3-tetrafluoropropionyl fluoride, 97%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-bromo-2,3,3,3-tetrafluoropropanoyl fluoride (CAS 6129-62-0) is a chemical compound with the molecular formula C3BrF5O and a molecular weight of 226.93 g/mol. IUPAC name: 2-bromo-2,3,3,3-tetrafluoropropanoyl fluoride. InChIKey: GHRAJKIIZHDCNR-UHFFFAOYSA-N.

Identity
Molecular formulaC3BrF5O
Molecular weight226.93 g/mol
IUPAC name2-bromo-2,3,3,3-tetrafluoropropanoyl fluoride
InChIKeyGHRAJKIIZHDCNR-UHFFFAOYSA-N
SMILESC(=O)(C(C(F)(F)F)(F)Br)F

Computed by PubChem (NCBI)