CAS 933668-42-9 is the registry number for 2-Bromo-2-(trifluoromethyl)difluorooxirane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-bromo-3,3-difluoro-2-(trifluoromethyl)oxirane (CAS 933668-42-9) is a chemical compound with the molecular formula C3BrF5O and a molecular weight of 226.93 g/mol. IUPAC name: 2-bromo-3,3-difluoro-2-(trifluoromethyl)oxirane. InChIKey: HWOIHZPYLYTJGZ-UHFFFAOYSA-N.
| Molecular formula | C3BrF5O |
|---|---|
| Molecular weight | 226.93 g/mol |
| IUPAC name | 2-bromo-3,3-difluoro-2-(trifluoromethyl)oxirane |
| InChIKey | HWOIHZPYLYTJGZ-UHFFFAOYSA-N |
| SMILES | C1(C(O1)(F)F)(C(F)(F)F)Br |
Computed by PubChem (NCBI)