CAS 61338-34-9 is the registry number for 6,8-Dichloro-4-hydroxyquinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6,8-dichloro-4-oxo-1H-quinoline-3-carbonitrile (CAS 61338-34-9) is a chemical compound with the molecular formula C10H4Cl2N2O and a molecular weight of 239.05 g/mol. IUPAC name: 6,8-dichloro-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: QPJHYFRMQTUEID-UHFFFAOYSA-N.
| Molecular formula | C10H4Cl2N2O |
|---|---|
| Molecular weight | 239.05 g/mol |
| IUPAC name | 6,8-dichloro-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | QPJHYFRMQTUEID-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=CN2)C#N)Cl)Cl |
Computed by PubChem (NCBI)