CAS 613669-18-4 appears in our catalog under these names: 2-(1-Naphthalenyloxy)-benzoic acid, 95%, 2-(Naphthalen-1-yloxy)benzoic acid, 95+%, 2–(1–Naphthalenyloxy)–Benzoic Acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
2-naphthalen-1-yloxybenzoic acid (CAS 613669-18-4) is a chemical compound with the molecular formula C17H12O3 and a molecular weight of 264.27 g/mol. IUPAC name: 2-naphthalen-1-yloxybenzoic acid. InChIKey: UHYMCGZSUOMOPR-UHFFFAOYSA-N.
| Molecular formula | C17H12O3 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 2-naphthalen-1-yloxybenzoic acid |
| InChIKey | UHYMCGZSUOMOPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OC3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)