CAS 7003-69-2 is the registry number for 3,5-Diphenylcyclopentane-1,2,4-trione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-diphenylcyclopentane-1,2,4-trione (CAS 7003-69-2) is a chemical compound with the molecular formula C17H12O3 and a molecular weight of 264.27 g/mol. IUPAC name: 3,5-diphenylcyclopentane-1,2,4-trione. InChIKey: OHQNFRSPZUPPSG-UHFFFAOYSA-N.
| Molecular formula | C17H12O3 |
|---|---|
| Molecular weight | 264.27 g/mol |
| IUPAC name | 3,5-diphenylcyclopentane-1,2,4-trione |
| InChIKey | OHQNFRSPZUPPSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2C(=O)C(C(=O)C2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)