CAS 61382-20-5 is the registry number for 5-Nitro-2-(pyridin-3-yl)benzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-2-pyridin-3-yl-1,3-benzoxazole (CAS 61382-20-5) is a chemical compound with the molecular formula C12H7N3O3 and a molecular weight of 241.20 g/mol. IUPAC name: 5-nitro-2-pyridin-3-yl-1,3-benzoxazole. InChIKey: KLYBDXWMSUKNSH-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O3 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 5-nitro-2-pyridin-3-yl-1,3-benzoxazole |
| InChIKey | KLYBDXWMSUKNSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC3=C(O2)C=CC(=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)