CAS 98293-81-3 appears in our catalog under these names: Milrinone Impurity 3, Milrinone Impurity C, Milrinone Impurity 16, 5-Cyano-1,6-dihydro-6-oxo-(3,4'-bipyridine)-2-carboxylic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-cyano-6-oxo-3-pyridin-4-yl-1H-pyridine-2-carboxylic acid (CAS 98293-81-3) is a chemical compound with the molecular formula C12H7N3O3 and a molecular weight of 241.20 g/mol. IUPAC name: 5-cyano-6-oxo-3-pyridin-4-yl-1H-pyridine-2-carboxylic acid. InChIKey: NWLZFLPKASPJMU-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O3 |
|---|---|
| Molecular weight | 241.20 g/mol |
| IUPAC name | 5-cyano-6-oxo-3-pyridin-4-yl-1H-pyridine-2-carboxylic acid |
| InChIKey | NWLZFLPKASPJMU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=C(NC(=O)C(=C2)C#N)C(=O)O |
Computed by PubChem (NCBI)