CAS 61382-84-1 appears in our catalog under these names: Irsogladine Impurity 2, Irsogladine Impurity 8. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one (CAS 61382-84-1) is a chemical compound with the molecular formula C9H6Cl2N4O and a molecular weight of 257.07 g/mol. IUPAC name: 4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one. InChIKey: LIUAWCQCHQAWLT-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N4O |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | 4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one |
| InChIKey | LIUAWCQCHQAWLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=NC(=NC(=O)N2)N)Cl |
Computed by PubChem (NCBI)