CAS 897361-59-0 is the registry number for N-(4,6-Dichloropyrido[3,2-d]pyrimidin-2-yl)acetamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4,6-dichloropyrido[3,2-d]pyrimidin-2-yl)acetamide (CAS 897361-59-0) is a chemical compound with the molecular formula C9H6Cl2N4O and a molecular weight of 257.07 g/mol. IUPAC name: N-(4,6-dichloropyrido[3,2-d]pyrimidin-2-yl)acetamide. InChIKey: CLQJIYHHDAXRQJ-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N4O |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | N-(4,6-dichloropyrido[3,2-d]pyrimidin-2-yl)acetamide |
| InChIKey | CLQJIYHHDAXRQJ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C(=N1)Cl)N=C(C=C2)Cl |
Computed by PubChem (NCBI)