CAS 61389-11-5 is the registry number for 5-(2-Chloroacetamido)benzene-1,3-dicarboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylic acid (CAS 61389-11-5) is a chemical compound with the molecular formula C10H8ClNO5 and a molecular weight of 257.63 g/mol. IUPAC name: 5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylic acid. InChIKey: JIXLTJSFSIQKEI-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO5 |
|---|---|
| Molecular weight | 257.63 g/mol |
| IUPAC name | 5-[(2-chloroacetyl)amino]benzene-1,3-dicarboxylic acid |
| InChIKey | JIXLTJSFSIQKEI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)NC(=O)CCl)C(=O)O |
Computed by PubChem (NCBI)