CAS 926239-75-0 is the registry number for 6-Chloro-8-nitro-3,4-dihydro-2H-1-benzopyran-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6-chloro-8-nitro-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 926239-75-0) is a chemical compound with the molecular formula C10H8ClNO5 and a molecular weight of 257.63 g/mol. IUPAC name: 6-chloro-8-nitro-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: RYTMVTXXMSRLGT-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO5 |
|---|---|
| Molecular weight | 257.63 g/mol |
| IUPAC name | 6-chloro-8-nitro-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | RYTMVTXXMSRLGT-UHFFFAOYSA-N |
| SMILES | C1C(COC2=C1C=C(C=C2[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)