Products 61470-08-4
CAS 61470-08-4 is the registry number for 4-Hydroxybufuralol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-(tert-butylamino)-1-hydroxyethyl]-7-ethyl-1-benzofuran-4-ol (CAS 61470-08-4) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: 2-[2-(tert-butylamino)-1-hydroxyethyl]-7-ethyl-1-benzofuran-4-ol. InChIKey: VWEQAYFMBKZBLK-UHFFFAOYSA-N.
| Molecular formula | C16H23NO3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | 2-[2-(tert-butylamino)-1-hydroxyethyl]-7-ethyl-1-benzofuran-4-ol |
| InChIKey | VWEQAYFMBKZBLK-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=C(C=C1)O)C=C(O2)C(CNC(C)(C)C)O |
Computed by PubChem (NCBI)