CAS 61532-33-0 is the registry number for 3-Phenyl-3H-imidazo(4,5-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-phenylimidazo[4,5-b]pyridine (CAS 61532-33-0) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 3-phenylimidazo[4,5-b]pyridine. InChIKey: AGQWNWPWJSILEU-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-phenylimidazo[4,5-b]pyridine |
| InChIKey | AGQWNWPWJSILEU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2N=CC=C3 |
Computed by PubChem (NCBI)