CAS 61532-35-2 appears in our catalog under these names: 1-Phenyl-1H-imidazo(4,5-c)pyridine, 95+%, 1-Phenyl-1H-imidazo(4,5-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-phenylimidazo[4,5-c]pyridine (CAS 61532-35-2) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: 1-phenylimidazo[4,5-c]pyridine. InChIKey: CTOGPLXHZSSJBE-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 1-phenylimidazo[4,5-c]pyridine |
| InChIKey | CTOGPLXHZSSJBE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2C=CN=C3 |
Computed by PubChem (NCBI)