Products 61693-75-2
CAS 61693-75-2 is the registry number for 2,2-Dichloro-1-(4-fluorophenyl)ethanol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2,2-dichloro-1-(4-fluorophenyl)ethanol (CAS 61693-75-2) is a chemical compound with the molecular formula C8H7Cl2FO and a molecular weight of 209.04 g/mol. IUPAC name: 2,2-dichloro-1-(4-fluorophenyl)ethanol. InChIKey: UVKGWSCOUJBBPI-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2FO |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-fluorophenyl)ethanol |
| InChIKey | UVKGWSCOUJBBPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(Cl)Cl)O)F |
Computed by PubChem (NCBI)