CAS 2586125-81-5 appears in our catalog under these names: (4,5-Dichloro-2-fluoro-3-methylphenyl)methanol, 95%, (4,5-Dichloro-2-fluoro-3-methylphenyl)methanol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(4,5-dichloro-2-fluoro-3-methylphenyl)methanol (CAS 2586125-81-5) is a chemical compound with the molecular formula C8H7Cl2FO and a molecular weight of 209.04 g/mol. IUPAC name: (4,5-dichloro-2-fluoro-3-methylphenyl)methanol. InChIKey: PTKKWVRTKGOFHJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2FO |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | (4,5-dichloro-2-fluoro-3-methylphenyl)methanol |
| InChIKey | PTKKWVRTKGOFHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1Cl)Cl)CO)F |
Computed by PubChem (NCBI)