CAS 1571065-36-5 is the registry number for 2-(2,6-Dichloro-3-fluorophenyl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,6-dichloro-3-fluorophenyl)ethanol (CAS 1571065-36-5) is a chemical compound with the molecular formula C8H7Cl2FO and a molecular weight of 209.04 g/mol. IUPAC name: 2-(2,6-dichloro-3-fluorophenyl)ethanol. InChIKey: GXBCRVJHEZJOIN-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2FO |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 2-(2,6-dichloro-3-fluorophenyl)ethanol |
| InChIKey | GXBCRVJHEZJOIN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)Cl)CCO)Cl |
Computed by PubChem (NCBI)