CAS 61799-78-8 appears in our catalog under these names: 4-Chloro-n,2-dihydroxybenzamide, 95%, 4-Chloro-N,2-dihydroxybenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
4-chloro-N,2-dihydroxybenzamide (CAS 61799-78-8) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 4-chloro-N,2-dihydroxybenzamide. InChIKey: YNWLFKLVCQDVSL-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 4-chloro-N,2-dihydroxybenzamide |
| InChIKey | YNWLFKLVCQDVSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)O)C(=O)NO |
Computed by PubChem (NCBI)