Products 618-61-1
CAS 618-61-1 appears in our catalog under these names: 3-Methyl-5-nitroaniline, 96%, 3–Methyl–5–nitroaniline, 3-Methyl-5-nitroaniline 98%, 3-Methyl-5-nitroaniline, 97%, 97%, 3-Methyl-5-nitroaniline, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100mg, 100g.
3-methyl-5-nitroaniline (CAS 618-61-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 3-methyl-5-nitroaniline. InChIKey: DZIJEXQVMORGQX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 3-methyl-5-nitroaniline |
| InChIKey | DZIJEXQVMORGQX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)