CAS 61888-37-7 appears in our catalog under these names: 5–(4–Methylphenyl)cyclohexane–1,3–dione, 5-(p-Tolyl)cyclohexane-1,3-dione, 97%, 97%, 5-(4-Methylphenyl)cyclohexane-1,3-dione, 98%, 5-(4-methylphenyl)cyclohexane-1,3-dione, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 2.5g.
5-(4-methylphenyl)cyclohexane-1,3-dione (CAS 61888-37-7) is a chemical compound with the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. IUPAC name: 5-(4-methylphenyl)cyclohexane-1,3-dione. InChIKey: NFJVIBUOAMVFME-UHFFFAOYSA-N.
| Molecular formula | C13H14O2 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 5-(4-methylphenyl)cyclohexane-1,3-dione |
| InChIKey | NFJVIBUOAMVFME-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2CC(=O)CC(=O)C2 |
Computed by PubChem (NCBI)