CAS 62100-29-2 appears in our catalog under these names: 2-(1-Methylene-3-oxoisoindolin-2-yl)propanoic acid, 98%, 2-(1-Methylene-3-oxo-1,3-dihydro-2h-isoindol-2-yl)propanoic acid, 95%, 1,3-Dihydro-±-methyl-1-methylene-3-oxo-2H-isoindole-2-acetic acid. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2-(1-methylidene-3-oxoisoindol-2-yl)propanoic acid (CAS 62100-29-2) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 2-(1-methylidene-3-oxoisoindol-2-yl)propanoic acid. InChIKey: BUVFACKZPHADQE-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 2-(1-methylidene-3-oxoisoindol-2-yl)propanoic acid |
| InChIKey | BUVFACKZPHADQE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=C)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)