CAS 6211-32-1 appears in our catalog under these names: Rauwolscine hydrochloride, ROTICHROM® CHR, 1 g, glass, Rauwolscine HCl, Rauwolscine hydrochloride/ 100%, Rauwolscine hydrochloride, Rauwolscine hydrochloride, 99% . Offered by: Roth, Chemat Brand, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, on request, 50mg, 100mg, 500mg, 250mg, 0,05g, 0,025g.
Methyl (1S,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride (CAS 6211-32-1) is a chemical compound with the molecular formula C21H27ClN2O3 and a molecular weight of 390.9 g/mol. IUPAC name: methyl (1S,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride. InChIKey: PIPZGJSEDRMUAW-ZKKXXTDSSA-N.
| Molecular formula | C21H27ClN2O3 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | methyl (1S,15S,18S,19S,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride |
| InChIKey | PIPZGJSEDRMUAW-ZKKXXTDSSA-N |
| SMILES | COC(=O)[C@@H]1[C@H](CC[C@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O.Cl |
Computed by PubChem (NCBI)