Products 65-19-0
CAS 65-19-0 appears in our catalog under these names: Yohimbine hydrochloride, 98%, Yohimbine HCl, Yohimbine Hydrochloride, >95% (HPLC), Yohimbine Hydrochloride, Yohimbine Hydrochloride. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 800mg, on request, 1g, 50mg, 5g, 250mg, 10mg, 10mM (in 1ml dmso).
Methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride (CAS 65-19-0) is a chemical compound with the molecular formula C21H27ClN2O3 and a molecular weight of 390.9 g/mol. IUPAC name: methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride. InChIKey: PIPZGJSEDRMUAW-VJDCAHTMSA-N.
| Molecular formula | C21H27ClN2O3 |
|---|---|
| Molecular weight | 390.9 g/mol |
| IUPAC name | methyl (1S,15R,18S,19R,20S)-18-hydroxy-1,3,11,12,14,15,16,17,18,19,20,21-dodecahydroyohimban-19-carboxylate;hydrochloride |
| InChIKey | PIPZGJSEDRMUAW-VJDCAHTMSA-N |
| SMILES | COC(=O)[C@H]1[C@H](CC[C@@H]2[C@@H]1C[C@H]3C4=C(CCN3C2)C5=CC=CC=C5N4)O.Cl |
Computed by PubChem (NCBI)