CAS 62128-38-5 appears in our catalog under these names: 3-(4-Chlorobenzoyl)-1h-pyrrole, 95%, (4–Chlorophenyl)(1H–pyrrol–3–yl)methanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(4-chlorophenyl)-(1H-pyrrol-3-yl)methanone (CAS 62128-38-5) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: (4-chlorophenyl)-(1H-pyrrol-3-yl)methanone. InChIKey: AHSLXEUIQZMKFA-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | (4-chlorophenyl)-(1H-pyrrol-3-yl)methanone |
| InChIKey | AHSLXEUIQZMKFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CNC=C2)Cl |
Computed by PubChem (NCBI)