CAS 76053-43-5 is the registry number for 5-(4-Chlorophenyl)-2-hydroxypyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
5-(4-chlorophenyl)-1H-pyridin-2-one (CAS 76053-43-5) is a chemical compound with the molecular formula C11H8ClNO and a molecular weight of 205.64 g/mol. IUPAC name: 5-(4-chlorophenyl)-1H-pyridin-2-one. InChIKey: CICHMBLPJGYPGW-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-1H-pyridin-2-one |
| InChIKey | CICHMBLPJGYPGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CNC(=O)C=C2)Cl |
Computed by PubChem (NCBI)