CAS 62144-03-0 is the registry number for Metronidazole Impurity 37. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-ethenyl-5-methyl-2-nitroimidazole (CAS 62144-03-0) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: 1-ethenyl-5-methyl-2-nitroimidazole. InChIKey: UCRJJHVREFVPPM-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 1-ethenyl-5-methyl-2-nitroimidazole |
| InChIKey | UCRJJHVREFVPPM-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N1C=C)[N+](=O)[O-] |
Computed by PubChem (NCBI)