Products 62149-40-0

CAS 62149-40-0 is the registry number for 2-Hydroxy-3-propoxypropyl methacrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2-hydroxy-3-propoxypropyl) 2-methylprop-2-enoate (CAS 62149-40-0) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: (2-hydroxy-3-propoxypropyl) 2-methylprop-2-enoate. InChIKey: KFRCUGRTYBIAHL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC name(2-hydroxy-3-propoxypropyl) 2-methylprop-2-enoate
InChIKeyKFRCUGRTYBIAHL-UHFFFAOYSA-N
SMILESCCCOCC(COC(=O)C(=C)C)O

Computed by PubChem (NCBI)