Products 622854-00-6
CAS 622854-00-6 is the registry number for (S)-1-(4-Hydroxyphenyl)ethane-1,2-diol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S)-1-(4-hydroxyphenyl)ethane-1,2-diol (CAS 622854-00-6) is a chemical compound with the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. IUPAC name: (1S)-1-(4-hydroxyphenyl)ethane-1,2-diol. InChIKey: VYRWCSXMABWFDW-MRVPVSSYSA-N.
| Molecular formula | C8H10O3 |
|---|---|
| Molecular weight | 154.16 g/mol |
| IUPAC name | (1S)-1-(4-hydroxyphenyl)ethane-1,2-diol |
| InChIKey | VYRWCSXMABWFDW-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CO)O)O |
Computed by PubChem (NCBI)