CAS 622864-54-4 appears in our catalog under these names: PD-407824, PD 407824, 98%, PD 407824/ 98.02% (existing batch purity), PD 407824, PD 407824. Offered by: TRC, AmBeed, TargetMol, GLPBio, Chemat. Available pack sizes: 500mg, 100mg, 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg.
9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione (CAS 622864-54-4) is a chemical compound with the molecular formula C20H12N2O3 and a molecular weight of 328.3 g/mol. IUPAC name: 9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione. InChIKey: IAUZTOZLTFSMIE-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O3 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| InChIKey | IAUZTOZLTFSMIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C4=C(N3)C=CC(=C4)O)C5=C2C(=O)NC5=O |
Computed by PubChem (NCBI)