PD 407824
cas: 622864-54-4 — see every product listed under this CAS number, including other names
PD 407824 (CAS 622864-54-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 100mg, 50mg, 2mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC18396-1 |
| cas | 622864-54-4 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 625.12 Pln | |
| GLPBio | 10mg | 1383.36 Pln | |
| GLPBio | 25mg | 2057.36 Pln | |
| GLPBio | 5mg | 943.40 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 793.62 Pln | |
| GLPBio | 1mg | 657.89 Pln | |
| GLPBio | 10mg | 1514.42 Pln | |
| GLPBio | 100mg | 6620.84 Pln | |
| GLPBio | 25mg | 2516.04 Pln | |
| GLPBio | 5mg | 1013.60 Pln | |
| GLPBio | 50mg | 3995.08 Pln | |
| Chemat | 25mg | 4730.00 Pln | |
| Chemat | 50mg | 7998.80 Pln | |
| Chemat | 2mg | 462.80 Pln |
properties
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione (CAS 622864-54-4) is a chemical compound with the molecular formula C20H12N2O3 and a molecular weight of 328.3 g/mol. IUPAC name: 9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione. InChIKey: IAUZTOZLTFSMIE-UHFFFAOYSA-N.
| Molecular formula | C20H12N2O3 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 9-hydroxy-4-phenyl-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| InChIKey | IAUZTOZLTFSMIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C4=C(N3)C=CC(=C4)O)C5=C2C(=O)NC5=O |
Computed by PubChem (NCBI)