CAS 62297-04-5 is the registry number for Diamantane-1,6-dicarboxylic Acid. Offered by: TRC. Available pack sizes: 50mg.
Pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1,6-dicarboxylic acid (CAS 62297-04-5) is a chemical compound with the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. IUPAC name: pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1,6-dicarboxylic acid. InChIKey: ZMEIRVUKJIFURD-UHFFFAOYSA-N.
| Molecular formula | C16H20O4 |
|---|---|
| Molecular weight | 276.33 g/mol |
| IUPAC name | pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane-1,6-dicarboxylic acid |
| InChIKey | ZMEIRVUKJIFURD-UHFFFAOYSA-N |
| SMILES | C1C2CC3C4CC5CC(C1C3(C5)C(=O)O)C4(C2)C(=O)O |
Computed by PubChem (NCBI)