CAS 623143-34-0 appears in our catalog under these names: (1S)-1-(3-Bromophenyl)propan-1-amine hydrochloride, 95%, (S)–1–(3–Bromophenyl)propan–1–amine hydrochloride, (1S)-1-(3-Bromophenyl)propan-1-amine hydrochloride, 97%, 97%, (S)-1-(3-Bromophenyl)propan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1S)-1-(3-bromophenyl)propan-1-amine;hydrochloride (CAS 623143-34-0) is a chemical compound with the molecular formula C9H13BrClN and a molecular weight of 250.56 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)propan-1-amine;hydrochloride. InChIKey: IGJRCDFUDNGJIS-FVGYRXGTSA-N.
| Molecular formula | C9H13BrClN |
|---|---|
| Molecular weight | 250.56 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)propan-1-amine;hydrochloride |
| InChIKey | IGJRCDFUDNGJIS-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)