CAS 62351-82-0 is the registry number for 1,2-dimethyl 4-(2,5-dioxopyrrol-1-yl)phthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Dimethyl 4-(2,5-dioxopyrrol-1-yl)benzene-1,2-dicarboxylate (CAS 62351-82-0) is a chemical compound with the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. IUPAC name: dimethyl 4-(2,5-dioxopyrrol-1-yl)benzene-1,2-dicarboxylate. InChIKey: YBGVBKPWEJWRSW-UHFFFAOYSA-N.
| Molecular formula | C14H11NO6 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | dimethyl 4-(2,5-dioxopyrrol-1-yl)benzene-1,2-dicarboxylate |
| InChIKey | YBGVBKPWEJWRSW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)N2C(=O)C=CC2=O)C(=O)OC |
Computed by PubChem (NCBI)